C20H19FN4O4S — CID 11495694
15-fluoro-4-[(1-methylsulfonylpiperidin-3-yl)amino]-5-oxa-3,10-diazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),3,7(12),8,14,16-heptaen-11-one (PubChem CID 11495694) has the molecular formula C20H19FN4O4S and a molecular weight of 430.46 g/mol. Its IUPAC name is 15-fluoro-4-[(1-methylsulfonylpiperidin-3-yl)amino]-5-oxa-3,10-diazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),3,7(12),8,14,16-heptaen-11-one.
| Compound Name | 15-fluoro-4-[(1-methylsulfonylpiperidin-3-yl)amino]-5-oxa-3,10-diazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),3,7(12),8,14,16-heptaen-11-one |
|---|---|
| PubChem CID | 11495694 |
| Molecular Formula | C20H19FN4O4S |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.11 |
| IUPAC Name | 15-fluoro-4-[(1-methylsulfonylpiperidin-3-yl)amino]-5-oxa-3,10-diazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),3,7(12),8,14,16-heptaen-11-one |
| SMILES | CS(=O)(=O)N1CCCC(Nc2nc3c4ccc(F)cc4c4c(=O)[nH]ccc4c3o2)C1 |
| InChI | InChI=1S/C20H19FN4O4S/c1-30(27,28)25-8-2-3-12(10-25)23-20-24-17-13-5-4-11(21)9-15(13)16-14(18(17)29-20)6-7-22-19(16)26/h4-7,9,12H,2-3,8,10H2,1H3,(H,22,26)(H,23,24) |
| InChIKey | CQIKCVDJJZPJOL-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 108.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|