About 7-[(4-chlorophenoxy)methyl]-1-[(4-fluorophenyl)methyl]-2,3-dimethylpyrrolo[2,3-c]pyridine
7-[(4-chlorophenoxy)methyl]-1-[(4-fluorophenyl)methyl]-2,3-dimethylpyrrolo[2,3-c]pyridine (PubChem CID 11495715) has the molecular formula C23H20ClFN2O
and a molecular weight of 394.88 g/mol. Its IUPAC name is 7-[(4-chlorophenoxy)methyl]-1-[(4-fluorophenyl)methyl]-2,3-dimethylpyrrolo[2,3-c]pyridine.
Molecular Properties
| Compound Name | 7-[(4-chlorophenoxy)methyl]-1-[(4-fluorophenyl)methyl]-2,3-dimethylpyrrolo[2,3-c]pyridine |
| PubChem CID | 11495715 |
| Molecular Formula | C23H20ClFN2O |
| Molecular Weight | 394.88 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | 7-[(4-chlorophenoxy)methyl]-1-[(4-fluorophenyl)methyl]-2,3-dimethylpyrrolo[2,3-c]pyridine |
| SMILES | Cc1c(C)n(Cc2ccc(F)cc2)c2c(COc3ccc(Cl)cc3)nccc12 |
| InChI | InChI=1S/C23H20ClFN2O/c1-15-16(2)27(13-17-3-7-19(25)8-4-17)23-21(15)11-12-26-22(23)14-28-20-9-5-18(24)6-10-20/h3-12H,13-14H2,1-2H3 |
| InChIKey | MCPDGFZLMREFTG-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 394.88 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-[(4-chlorophenoxy)methyl]-1-[(4-fluorophenyl)methyl]-2,3-dimethylpyrrolo[2,3-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[(4-chlorophenoxy)methyl]-1-[(4-fluorophenyl)methyl]-2,3-dimethylpyrrolo[2,3-c]pyridine?
The IUPAC name of 7-[(4-chlorophenoxy)methyl]-1-[(4-fluorophenyl)methyl]-2,3-dimethylpyrrolo[2,3-c]pyridine (CID 11495715) is 7-[(4-chlorophenoxy)methyl]-1-[(4-fluorophenyl)methyl]-2,3-dimethylpyrrolo[2,3-c]pyridine.
What is the SMILES notation for 7-[(4-chlorophenoxy)methyl]-1-[(4-fluorophenyl)methyl]-2,3-dimethylpyrrolo[2,3-c]pyridine?
The canonical SMILES for 7-[(4-chlorophenoxy)methyl]-1-[(4-fluorophenyl)methyl]-2,3-dimethylpyrrolo[2,3-c]pyridine is Cc1c(C)n(Cc2ccc(F)cc2)c2c(COc3ccc(Cl)cc3)nccc12.
What is the InChIKey of 7-[(4-chlorophenoxy)methyl]-1-[(4-fluorophenyl)methyl]-2,3-dimethylpyrrolo[2,3-c]pyridine?
The InChIKey is MCPDGFZLMREFTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H20ClFN2O/c1-15-16(2)27(13-17-3-7-19(25)8-4-17)23-21(15)11-12-26-22(23)14-28-20-9-5-18(24)6-10-20/h3-12H,13-14H2,1-2H3.
What are the key properties of 7-[(4-chlorophenoxy)methyl]-1-[(4-fluorophenyl)methyl]-2,3-dimethylpyrrolo[2,3-c]pyridine?
7-[(4-chlorophenoxy)methyl]-1-[(4-fluorophenyl)methyl]-2,3-dimethylpyrrolo[2,3-c]pyridine has a molecular weight of 394.88 g/mol, XLogP of 6.07, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[(4-chlorophenoxy)methyl]-1-[(4-fluorophenyl)methyl]-2,3-dimethylpyrrolo[2,3-c]pyridine is sourced from PubChem (CID 11495715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).