C14H23N3 — CID 114957425
5-ethyl-1-[(4-methyl-3-pyridinyl)methyl]-1,4-diazepane (PubChem CID 114957425) has the molecular formula C14H23N3 and a molecular weight of 233.36 g/mol. Its IUPAC name is 5-ethyl-1-[(4-methyl-3-pyridinyl)methyl]-1,4-diazepane.
| Compound Name | 5-ethyl-1-[(4-methyl-3-pyridinyl)methyl]-1,4-diazepane |
|---|---|
| PubChem CID | 114957425 |
| Molecular Formula | C14H23N3 |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.19 |
| IUPAC Name | 5-ethyl-1-[(4-methyl-3-pyridinyl)methyl]-1,4-diazepane |
| SMILES | CCC1CCN(Cc2cnccc2C)CCN1 |
| InChI | InChI=1S/C14H23N3/c1-3-14-5-8-17(9-7-16-14)11-13-10-15-6-4-12(13)2/h4,6,10,14,16H,3,5,7-9,11H2,1-2H3 |
| InChIKey | QFEUXTAZKRAJBN-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |