C21H29ISi — CID 11495799
12-iodododeca-2,4,9,11-tetraynyl-tri(propan-2-yl)silane (PubChem CID 11495799) has the molecular formula C21H29ISi and a molecular weight of 436.45 g/mol. Its IUPAC name is 12-iodododeca-2,4,9,11-tetraynyl-tri(propan-2-yl)silane.
| Compound Name | 12-iodododeca-2,4,9,11-tetraynyl-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 11495799 |
| Molecular Formula | C21H29ISi |
| Molecular Weight | 436.45 g/mol |
| Exact Mass | 436.11 |
| IUPAC Name | 12-iodododeca-2,4,9,11-tetraynyl-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](CC#CC#CCCCC#CC#CI)(C(C)C)C(C)C |
| InChI | InChI=1S/C21H29ISi/c1-19(2)23(20(3)4,21(5)6)18-16-14-12-10-8-7-9-11-13-15-17-22/h19-21H,7-9,18H2,1-6H3 |
| InChIKey | ZXNGYDVLQJGGMK-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.45 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|