C15H17N3O3 — CID 114958048
9-[(4-methyl-3-pyridinyl)methyl]-7,9-diazaspiro[4.5]decane-6,8,10-trione (PubChem CID 114958048) has the molecular formula C15H17N3O3 and a molecular weight of 287.32 g/mol. Its IUPAC name is 9-[(4-methyl-3-pyridinyl)methyl]-7,9-diazaspiro[4.5]decane-6,8,10-trione.
| Compound Name | 9-[(4-methyl-3-pyridinyl)methyl]-7,9-diazaspiro[4.5]decane-6,8,10-trione |
|---|---|
| PubChem CID | 114958048 |
| Molecular Formula | C15H17N3O3 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | 9-[(4-methyl-3-pyridinyl)methyl]-7,9-diazaspiro[4.5]decane-6,8,10-trione |
| SMILES | Cc1ccncc1CN1C(=O)NC(=O)C2(CCCC2)C1=O |
| InChI | InChI=1S/C15H17N3O3/c1-10-4-7-16-8-11(10)9-18-13(20)15(5-2-3-6-15)12(19)17-14(18)21/h4,7-8H,2-3,5-6,9H2,1H3,(H,17,19,21) |
| InChIKey | RIQZHAMLYLNTCT-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|