N-[1-(diethylamino)propan-2-yl]sulfamoyl chloride

C7H17ClN2O2S — CID 114958265

IUPACN-[1-(diethylamino)propan-2-yl]sulfamoyl chloride
SMILESCCN(CC)CC(C)NS(=O)(=O)Cl
InChIInChI=1S/C7H17ClN2O2S/c1-4-10(5-2)6-7(3)9-13(8,11)12/h7,9H,4-6H2,1-3H3
InChIKeyJWAYUUYGARRMJW-UHFFFAOYSA-N
MW228.74 g/mol
LogP0.79
Rot. Bonds6

About N-[1-(diethylamino)propan-2-yl]sulfamoyl chloride

N-[1-(diethylamino)propan-2-yl]sulfamoyl chloride (PubChem CID 114958265) has the molecular formula C7H17ClN2O2S and a molecular weight of 228.74 g/mol. Its IUPAC name is N-[1-(diethylamino)propan-2-yl]sulfamoyl chloride.

Molecular Properties

Compound NameN-[1-(diethylamino)propan-2-yl]sulfamoyl chloride
PubChem CID114958265
Molecular FormulaC7H17ClN2O2S
Molecular Weight228.74 g/mol
Exact Mass228.07
IUPAC NameN-[1-(diethylamino)propan-2-yl]sulfamoyl chloride
SMILESCCN(CC)CC(C)NS(=O)(=O)Cl
InChIInChI=1S/C7H17ClN2O2S/c1-4-10(5-2)6-7(3)9-13(8,11)12/h7,9H,4-6H2,1-3H3
InChIKeyJWAYUUYGARRMJW-UHFFFAOYSA-N
XLogP0.79
TPSA49.41 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500228.74
LogP ≤ 50.79
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze N-[1-(diethylamino)propan-2-yl]sulfamoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N-[1-(diethylamino)propan-2-yl]sulfamoyl chloride?
The IUPAC name of N-[1-(diethylamino)propan-2-yl]sulfamoyl chloride (CID 114958265) is N-[1-(diethylamino)propan-2-yl]sulfamoyl chloride.
What is the SMILES notation for N-[1-(diethylamino)propan-2-yl]sulfamoyl chloride?
The canonical SMILES for N-[1-(diethylamino)propan-2-yl]sulfamoyl chloride is CCN(CC)CC(C)NS(=O)(=O)Cl.
What is the InChIKey of N-[1-(diethylamino)propan-2-yl]sulfamoyl chloride?
The InChIKey is JWAYUUYGARRMJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H17ClN2O2S/c1-4-10(5-2)6-7(3)9-13(8,11)12/h7,9H,4-6H2,1-3H3.
What are the key properties of N-[1-(diethylamino)propan-2-yl]sulfamoyl chloride?
N-[1-(diethylamino)propan-2-yl]sulfamoyl chloride has a molecular weight of 228.74 g/mol, XLogP of 0.79, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(diethylamino)propan-2-yl]sulfamoyl chloride is sourced from PubChem (CID 114958265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).