About 4-amino-1,3-dimethyl-5-(sulfamoylamino)pyrazole
4-amino-1,3-dimethyl-5-(sulfamoylamino)pyrazole (PubChem CID 114958732) has the molecular formula C5H11N5O2S
and a molecular weight of 205.24 g/mol. Its IUPAC name is 4-amino-1,3-dimethyl-5-(sulfamoylamino)pyrazole.
Molecular Properties
| Compound Name | 4-amino-1,3-dimethyl-5-(sulfamoylamino)pyrazole |
| PubChem CID | 114958732 |
| Molecular Formula | C5H11N5O2S |
| Molecular Weight | 205.24 g/mol |
| Exact Mass | 205.06 |
| IUPAC Name | 4-amino-1,3-dimethyl-5-(sulfamoylamino)pyrazole |
| SMILES | Cc1nn(C)c(NS(N)(=O)=O)c1N |
| InChI | InChI=1S/C5H11N5O2S/c1-3-4(6)5(10(2)8-3)9-13(7,11)12/h9H,6H2,1-2H3,(H2,7,11,12) |
| InChIKey | QQJHKKHCTZDORY-UHFFFAOYSA-N |
| XLogP | -1.07 |
| TPSA | 116.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.24 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-amino-1,3-dimethyl-5-(sulfamoylamino)pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-1,3-dimethyl-5-(sulfamoylamino)pyrazole?
The IUPAC name of 4-amino-1,3-dimethyl-5-(sulfamoylamino)pyrazole (CID 114958732) is 4-amino-1,3-dimethyl-5-(sulfamoylamino)pyrazole.
What is the SMILES notation for 4-amino-1,3-dimethyl-5-(sulfamoylamino)pyrazole?
The canonical SMILES for 4-amino-1,3-dimethyl-5-(sulfamoylamino)pyrazole is Cc1nn(C)c(NS(N)(=O)=O)c1N.
What is the InChIKey of 4-amino-1,3-dimethyl-5-(sulfamoylamino)pyrazole?
The InChIKey is QQJHKKHCTZDORY-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11N5O2S/c1-3-4(6)5(10(2)8-3)9-13(7,11)12/h9H,6H2,1-2H3,(H2,7,11,12).
What are the key properties of 4-amino-1,3-dimethyl-5-(sulfamoylamino)pyrazole?
4-amino-1,3-dimethyl-5-(sulfamoylamino)pyrazole has a molecular weight of 205.24 g/mol, XLogP of -1.07, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-1,3-dimethyl-5-(sulfamoylamino)pyrazole is sourced from PubChem (CID 114958732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).