C6H9N3O4S2 — CID 114958949
2-[1-(sulfamoylamino)ethyl]-1,3-thiazole-4-carboxylic acid (PubChem CID 114958949) has the molecular formula C6H9N3O4S2 and a molecular weight of 251.29 g/mol. Its IUPAC name is 2-[1-(sulfamoylamino)ethyl]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[1-(sulfamoylamino)ethyl]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 114958949 |
| Molecular Formula | C6H9N3O4S2 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.00 |
| IUPAC Name | 2-[1-(sulfamoylamino)ethyl]-1,3-thiazole-4-carboxylic acid |
| SMILES | CC(NS(N)(=O)=O)c1nc(C(=O)O)cs1 |
| InChI | InChI=1S/C6H9N3O4S2/c1-3(9-15(7,12)13)5-8-4(2-14-5)6(10)11/h2-3,9H,1H3,(H,10,11)(H2,7,12,13) |
| InChIKey | QHPAFQFUOSAXGD-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 122.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |