C9H13N3O2S — CID 114959084
5-(sulfamoylamino)-1,2,3,4-tetrahydroisoquinoline (PubChem CID 114959084) has the molecular formula C9H13N3O2S and a molecular weight of 227.29 g/mol. Its IUPAC name is 5-(sulfamoylamino)-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | 5-(sulfamoylamino)-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 114959084 |
| Molecular Formula | C9H13N3O2S |
| Molecular Weight | 227.29 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | 5-(sulfamoylamino)-1,2,3,4-tetrahydroisoquinoline |
| SMILES | NS(=O)(=O)Nc1cccc2c1CCNC2 |
| InChI | InChI=1S/C9H13N3O2S/c10-15(13,14)12-9-3-1-2-7-6-11-5-4-8(7)9/h1-3,11-12H,4-6H2,(H2,10,13,14) |
| InChIKey | YJQKANMIGCFMIR-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.29 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |