C5H12N4O2S — CID 114959727
2-cyclopropyl-2-(sulfamoylamino)ethanimidamide (PubChem CID 114959727) has the molecular formula C5H12N4O2S and a molecular weight of 192.24 g/mol. Its IUPAC name is 2-cyclopropyl-2-(sulfamoylamino)ethanimidamide.
| Compound Name | 2-cyclopropyl-2-(sulfamoylamino)ethanimidamide |
|---|---|
| PubChem CID | 114959727 |
| Molecular Formula | C5H12N4O2S |
| Molecular Weight | 192.24 g/mol |
| Exact Mass | 192.07 |
| IUPAC Name | 2-cyclopropyl-2-(sulfamoylamino)ethanimidamide |
| SMILES | [H]/N=C(\N)C(NS(N)(=O)=O)C1CC1 |
| InChI | InChI=1S/C5H12N4O2S/c6-5(7)4(3-1-2-3)9-12(8,10)11/h3-4,9H,1-2H2,(H3,6,7)(H2,8,10,11) |
| InChIKey | ZEOLUEXNZRRDNU-UHFFFAOYSA-N |
| XLogP | -1.51 |
| TPSA | 122.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.24 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|