C28H23NO5 — CID 11496173
dimethyl 5'-(2,6-dimethylphenyl)iminospiro[fluorene-9,2'-furan]-3',4'-dicarboxylate (PubChem CID 11496173) has the molecular formula C28H23NO5 and a molecular weight of 453.49 g/mol. Its IUPAC name is dimethyl 5'-(2,6-dimethylphenyl)iminospiro[fluorene-9,2'-furan]-3',4'-dicarboxylate.
| Compound Name | dimethyl 5'-(2,6-dimethylphenyl)iminospiro[fluorene-9,2'-furan]-3',4'-dicarboxylate |
|---|---|
| PubChem CID | 11496173 |
| Molecular Formula | C28H23NO5 |
| Molecular Weight | 453.49 g/mol |
| Exact Mass | 453.16 |
| IUPAC Name | dimethyl 5'-(2,6-dimethylphenyl)iminospiro[fluorene-9,2'-furan]-3',4'-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)C2(O/C1=N\c1c(C)cccc1C)c1ccccc1-c1ccccc12 |
| InChI | InChI=1S/C28H23NO5/c1-16-10-9-11-17(2)24(16)29-25-22(26(30)32-3)23(27(31)33-4)28(34-25)20-14-7-5-12-18(20)19-13-6-8-15-21(19)28/h5-15H,1-4H3/b29-25- |
| InChIKey | WNNYXYMOSAOWCX-GNVQSUKOSA-N |
| XLogP | 4.93 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.49 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|