About N-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]-5-phenylpyridin-2-amine
N-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]-5-phenylpyridin-2-amine (PubChem CID 11496213) has the molecular formula C25H28Cl2N4
and a molecular weight of 455.43 g/mol. Its IUPAC name is N-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]-5-phenylpyridin-2-amine.
Molecular Properties
| Compound Name | N-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]-5-phenylpyridin-2-amine |
| PubChem CID | 11496213 |
| Molecular Formula | C25H28Cl2N4 |
| Molecular Weight | 455.43 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | N-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]-5-phenylpyridin-2-amine |
| SMILES | Clc1cccc(N2CCN(CCCCNc3ccc(-c4ccccc4)cn3)CC2)c1Cl |
| InChI | InChI=1S/C25H28Cl2N4/c26-22-9-6-10-23(25(22)27)31-17-15-30(16-18-31)14-5-4-13-28-24-12-11-21(19-29-24)20-7-2-1-3-8-20/h1-3,6-12,19H,4-5,13-18H2,(H,28,29) |
| InChIKey | WRUSBTCFXKDYJC-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 455.43 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]-5-phenylpyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]-5-phenylpyridin-2-amine?
The IUPAC name of N-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]-5-phenylpyridin-2-amine (CID 11496213) is N-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]-5-phenylpyridin-2-amine.
What is the SMILES notation for N-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]-5-phenylpyridin-2-amine?
The canonical SMILES for N-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]-5-phenylpyridin-2-amine is Clc1cccc(N2CCN(CCCCNc3ccc(-c4ccccc4)cn3)CC2)c1Cl.
What is the InChIKey of N-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]-5-phenylpyridin-2-amine?
The InChIKey is WRUSBTCFXKDYJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H28Cl2N4/c26-22-9-6-10-23(25(22)27)31-17-15-30(16-18-31)14-5-4-13-28-24-12-11-21(19-29-24)20-7-2-1-3-8-20/h1-3,6-12,19H,4-5,13-18H2,(H,28,29).
What are the key properties of N-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]-5-phenylpyridin-2-amine?
N-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]-5-phenylpyridin-2-amine has a molecular weight of 455.43 g/mol, XLogP of 6.07, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]-5-phenylpyridin-2-amine is sourced from PubChem (CID 11496213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).