About 2-[2-[bis(4-fluorophenyl)methyl]-4-(3,4-difluorophenyl)-1,3-thiazol-5-yl]acetic acid
2-[2-[bis(4-fluorophenyl)methyl]-4-(3,4-difluorophenyl)-1,3-thiazol-5-yl]acetic acid (PubChem CID 11496258) has the molecular formula C24H15F4NO2S
and a molecular weight of 457.45 g/mol. Its IUPAC name is 2-[2-[bis(4-fluorophenyl)methyl]-4-(3,4-difluorophenyl)-1,3-thiazol-5-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[2-[bis(4-fluorophenyl)methyl]-4-(3,4-difluorophenyl)-1,3-thiazol-5-yl]acetic acid |
| PubChem CID | 11496258 |
| Molecular Formula | C24H15F4NO2S |
| Molecular Weight | 457.45 g/mol |
| Exact Mass | 457.08 |
| IUPAC Name | 2-[2-[bis(4-fluorophenyl)methyl]-4-(3,4-difluorophenyl)-1,3-thiazol-5-yl]acetic acid |
| SMILES | O=C(O)Cc1sc(C(c2ccc(F)cc2)c2ccc(F)cc2)nc1-c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C24H15F4NO2S/c25-16-6-1-13(2-7-16)22(14-3-8-17(26)9-4-14)24-29-23(20(32-24)12-21(30)31)15-5-10-18(27)19(28)11-15/h1-11,22H,12H2,(H,30,31) |
| InChIKey | PMKHRUSPKPZZRI-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 457.45 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[2-[bis(4-fluorophenyl)methyl]-4-(3,4-difluorophenyl)-1,3-thiazol-5-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[bis(4-fluorophenyl)methyl]-4-(3,4-difluorophenyl)-1,3-thiazol-5-yl]acetic acid?
The IUPAC name of 2-[2-[bis(4-fluorophenyl)methyl]-4-(3,4-difluorophenyl)-1,3-thiazol-5-yl]acetic acid (CID 11496258) is 2-[2-[bis(4-fluorophenyl)methyl]-4-(3,4-difluorophenyl)-1,3-thiazol-5-yl]acetic acid.
What is the SMILES notation for 2-[2-[bis(4-fluorophenyl)methyl]-4-(3,4-difluorophenyl)-1,3-thiazol-5-yl]acetic acid?
The canonical SMILES for 2-[2-[bis(4-fluorophenyl)methyl]-4-(3,4-difluorophenyl)-1,3-thiazol-5-yl]acetic acid is O=C(O)Cc1sc(C(c2ccc(F)cc2)c2ccc(F)cc2)nc1-c1ccc(F)c(F)c1.
What is the InChIKey of 2-[2-[bis(4-fluorophenyl)methyl]-4-(3,4-difluorophenyl)-1,3-thiazol-5-yl]acetic acid?
The InChIKey is PMKHRUSPKPZZRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H15F4NO2S/c25-16-6-1-13(2-7-16)22(14-3-8-17(26)9-4-14)24-29-23(20(32-24)12-21(30)31)15-5-10-18(27)19(28)11-15/h1-11,22H,12H2,(H,30,31).
What are the key properties of 2-[2-[bis(4-fluorophenyl)methyl]-4-(3,4-difluorophenyl)-1,3-thiazol-5-yl]acetic acid?
2-[2-[bis(4-fluorophenyl)methyl]-4-(3,4-difluorophenyl)-1,3-thiazol-5-yl]acetic acid has a molecular weight of 457.45 g/mol, XLogP of 6.17, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[bis(4-fluorophenyl)methyl]-4-(3,4-difluorophenyl)-1,3-thiazol-5-yl]acetic acid is sourced from PubChem (CID 11496258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).