C15H22N2O — CID 114963969
1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl-(1-methylpyrazol-4-yl)methanone (PubChem CID 114963969) has the molecular formula C15H22N2O and a molecular weight of 246.35 g/mol. Its IUPAC name is 1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl-(1-methylpyrazol-4-yl)methanone.
| Compound Name | 1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl-(1-methylpyrazol-4-yl)methanone |
|---|---|
| PubChem CID | 114963969 |
| Molecular Formula | C15H22N2O |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | 1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl-(1-methylpyrazol-4-yl)methanone |
| SMILES | Cn1cc(C(=O)C2CCC3CCCCC3C2)cn1 |
| InChI | InChI=1S/C15H22N2O/c1-17-10-14(9-16-17)15(18)13-7-6-11-4-2-3-5-12(11)8-13/h9-13H,2-8H2,1H3 |
| InChIKey | WDJCPBVFOJJVNP-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |