C15H11BrF2O — CID 114964013
1-(2-bromo-5-methylphenyl)-2-(2,5-difluorophenyl)ethanone (PubChem CID 114964013) has the molecular formula C15H11BrF2O and a molecular weight of 325.15 g/mol. Its IUPAC name is 1-(2-bromo-5-methylphenyl)-2-(2,5-difluorophenyl)ethanone.
| Compound Name | 1-(2-bromo-5-methylphenyl)-2-(2,5-difluorophenyl)ethanone |
|---|---|
| PubChem CID | 114964013 |
| Molecular Formula | C15H11BrF2O |
| Molecular Weight | 325.15 g/mol |
| Exact Mass | 324.00 |
| IUPAC Name | 1-(2-bromo-5-methylphenyl)-2-(2,5-difluorophenyl)ethanone |
| SMILES | Cc1ccc(Br)c(C(=O)Cc2cc(F)ccc2F)c1 |
| InChI | InChI=1S/C15H11BrF2O/c1-9-2-4-13(16)12(6-9)15(19)8-10-7-11(17)3-5-14(10)18/h2-7H,8H2,1H3 |
| InChIKey | CKDDBFURCAKQPL-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.15 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |