C24H32N6S2 — CID 11496446
1-(1-adamantyl)-3-[[1-(1-adamantyl)-1,2,4-triazol-3-yl]disulfanyl]-1,2,4-triazole (PubChem CID 11496446) has the molecular formula C24H32N6S2 and a molecular weight of 468.70 g/mol. Its IUPAC name is 1-(1-adamantyl)-3-[[1-(1-adamantyl)-1,2,4-triazol-3-yl]disulfanyl]-1,2,4-triazole.
| Compound Name | 1-(1-adamantyl)-3-[[1-(1-adamantyl)-1,2,4-triazol-3-yl]disulfanyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 11496446 |
| Molecular Formula | C24H32N6S2 |
| Molecular Weight | 468.70 g/mol |
| Exact Mass | 468.21 |
| IUPAC Name | 1-(1-adamantyl)-3-[[1-(1-adamantyl)-1,2,4-triazol-3-yl]disulfanyl]-1,2,4-triazole |
| SMILES | c1nc(SSc2ncn(C34CC5CC(CC(C5)C3)C4)n2)nn1C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C24H32N6S2/c1-15-2-17-3-16(1)8-23(7-15,9-17)29-13-25-21(27-29)31-32-22-26-14-30(28-22)24-10-18-4-19(11-24)6-20(5-18)12-24/h13-20H,1-12H2 |
| InChIKey | KIKSUBJRJPBGRX-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.70 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|