C14H8Br2ClFO — CID 114967277
2-(2-chloro-4-fluorophenyl)-1-(2,5-dibromophenyl)ethanone (PubChem CID 114967277) has the molecular formula C14H8Br2ClFO and a molecular weight of 406.48 g/mol. Its IUPAC name is 2-(2-chloro-4-fluorophenyl)-1-(2,5-dibromophenyl)ethanone.
| Compound Name | 2-(2-chloro-4-fluorophenyl)-1-(2,5-dibromophenyl)ethanone |
|---|---|
| PubChem CID | 114967277 |
| Molecular Formula | C14H8Br2ClFO |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 403.86 |
| IUPAC Name | 2-(2-chloro-4-fluorophenyl)-1-(2,5-dibromophenyl)ethanone |
| SMILES | O=C(Cc1ccc(F)cc1Cl)c1cc(Br)ccc1Br |
| InChI | InChI=1S/C14H8Br2ClFO/c15-9-2-4-12(16)11(6-9)14(19)5-8-1-3-10(18)7-13(8)17/h1-4,6-7H,5H2 |
| InChIKey | PHGGVXKXZQDHBM-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |