C12H7BrCl2OS — CID 114967348
2-(5-bromothiophen-2-yl)-1-(2,5-dichlorophenyl)ethanone (PubChem CID 114967348) has the molecular formula C12H7BrCl2OS and a molecular weight of 350.06 g/mol. Its IUPAC name is 2-(5-bromothiophen-2-yl)-1-(2,5-dichlorophenyl)ethanone.
| Compound Name | 2-(5-bromothiophen-2-yl)-1-(2,5-dichlorophenyl)ethanone |
|---|---|
| PubChem CID | 114967348 |
| Molecular Formula | C12H7BrCl2OS |
| Molecular Weight | 350.06 g/mol |
| Exact Mass | 347.88 |
| IUPAC Name | 2-(5-bromothiophen-2-yl)-1-(2,5-dichlorophenyl)ethanone |
| SMILES | O=C(Cc1ccc(Br)s1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C12H7BrCl2OS/c13-12-4-2-8(17-12)6-11(16)9-5-7(14)1-3-10(9)15/h1-5H,6H2 |
| InChIKey | GYCIHQATYMFCNT-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.06 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |