C12H13BrOS — CID 114967448
1-(6-bicyclo[3.1.0]hexanyl)-2-(5-bromothiophen-2-yl)ethanone (PubChem CID 114967448) has the molecular formula C12H13BrOS and a molecular weight of 285.21 g/mol. Its IUPAC name is 1-(6-bicyclo[3.1.0]hexanyl)-2-(5-bromothiophen-2-yl)ethanone.
| Compound Name | 1-(6-bicyclo[3.1.0]hexanyl)-2-(5-bromothiophen-2-yl)ethanone |
|---|---|
| PubChem CID | 114967448 |
| Molecular Formula | C12H13BrOS |
| Molecular Weight | 285.21 g/mol |
| Exact Mass | 283.99 |
| IUPAC Name | 1-(6-bicyclo[3.1.0]hexanyl)-2-(5-bromothiophen-2-yl)ethanone |
| SMILES | O=C(Cc1ccc(Br)s1)C1C2CCCC21 |
| InChI | InChI=1S/C12H13BrOS/c13-11-5-4-7(15-11)6-10(14)12-8-2-1-3-9(8)12/h4-5,8-9,12H,1-3,6H2 |
| InChIKey | HLHAXODMUCNARR-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.21 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |