C27H28N6OS — CID 11496746
2-methyl-7-[2-[[4-methyl-5-(2-methylquinolin-5-yl)-1,2,4-triazol-3-yl]sulfanyl]ethyl]-5,6,8,9-tetrahydro-[1,3]oxazolo[4,5-h][3]benzazepine (PubChem CID 11496746) has the molecular formula C27H28N6OS and a molecular weight of 484.63 g/mol. Its IUPAC name is 2-methyl-7-[2-[[4-methyl-5-(2-methylquinolin-5-yl)-1,2,4-triazol-3-yl]sulfanyl]ethyl]-5,6,8,9-tetrahydro-[1,3]oxazolo[4,5-h][3]benzazepine.
| Compound Name | 2-methyl-7-[2-[[4-methyl-5-(2-methylquinolin-5-yl)-1,2,4-triazol-3-yl]sulfanyl]ethyl]-5,6,8,9-tetrahydro-[1,3]oxazolo[4,5-h][3]benzazepine |
|---|---|
| PubChem CID | 11496746 |
| Molecular Formula | C27H28N6OS |
| Molecular Weight | 484.63 g/mol |
| Exact Mass | 484.20 |
| IUPAC Name | 2-methyl-7-[2-[[4-methyl-5-(2-methylquinolin-5-yl)-1,2,4-triazol-3-yl]sulfanyl]ethyl]-5,6,8,9-tetrahydro-[1,3]oxazolo[4,5-h][3]benzazepine |
| SMILES | Cc1ccc2c(-c3nnc(SCCN4CCc5cc6nc(C)oc6cc5CC4)n3C)cccc2n1 |
| InChI | InChI=1S/C27H28N6OS/c1-17-7-8-21-22(5-4-6-23(21)28-17)26-30-31-27(32(26)3)35-14-13-33-11-9-19-15-24-25(34-18(2)29-24)16-20(19)10-12-33/h4-8,15-16H,9-14H2,1-3H3 |
| InChIKey | BYMRLNXYRMIIKD-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 72.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.63 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |