C16H22F2O — CID 114968684
1-(2,3-difluorophenyl)-4,6,6-trimethylheptan-2-one (PubChem CID 114968684) has the molecular formula C16H22F2O and a molecular weight of 268.35 g/mol. Its IUPAC name is 1-(2,3-difluorophenyl)-4,6,6-trimethylheptan-2-one.
| Compound Name | 1-(2,3-difluorophenyl)-4,6,6-trimethylheptan-2-one |
|---|---|
| PubChem CID | 114968684 |
| Molecular Formula | C16H22F2O |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | 1-(2,3-difluorophenyl)-4,6,6-trimethylheptan-2-one |
| SMILES | CC(CC(=O)Cc1cccc(F)c1F)CC(C)(C)C |
| InChI | InChI=1S/C16H22F2O/c1-11(10-16(2,3)4)8-13(19)9-12-6-5-7-14(17)15(12)18/h5-7,11H,8-10H2,1-4H3 |
| InChIKey | HHMCHDNACCZKRV-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |