C14H26O — CID 114970040
1-(1-ethylcyclopentyl)-4,4-dimethylpentan-1-one (PubChem CID 114970040) has the molecular formula C14H26O and a molecular weight of 210.36 g/mol. Its IUPAC name is 1-(1-ethylcyclopentyl)-4,4-dimethylpentan-1-one.
| Compound Name | 1-(1-ethylcyclopentyl)-4,4-dimethylpentan-1-one |
|---|---|
| PubChem CID | 114970040 |
| Molecular Formula | C14H26O |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.20 |
| IUPAC Name | 1-(1-ethylcyclopentyl)-4,4-dimethylpentan-1-one |
| SMILES | CCC1(C(=O)CCC(C)(C)C)CCCC1 |
| InChI | InChI=1S/C14H26O/c1-5-14(9-6-7-10-14)12(15)8-11-13(2,3)4/h5-11H2,1-4H3 |
| InChIKey | WKYVPTHSLUJIMP-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |