C29H44O7 — CID 11497064
[(2S,3R,4R,5R)-5-[[(1S,4aR,4bS,7S,8aS)-7-ethenyl-1,4b,7-trimethyl-3,4,4a,5,6,8,8a,9-octahydro-2H-phenanthren-1-yl]methoxy]-3-acetyloxy-4-hydroxyoxolan-2-yl]methyl acetate (PubChem CID 11497064) has the molecular formula C29H44O7 and a molecular weight of 504.66 g/mol. Its IUPAC name is [(2S,3R,4R,5R)-5-[[(1S,4aR,4bS,7S,8aS)-7-ethenyl-1,4b,7-trimethyl-3,4,4a,5,6,8,8a,9-octahydro-2H-phenanthren-1-yl]methoxy]-3-acetyloxy-4-hydroxyoxolan-2-yl]methyl acetate.
| Compound Name | [(2S,3R,4R,5R)-5-[[(1S,4aR,4bS,7S,8aS)-7-ethenyl-1,4b,7-trimethyl-3,4,4a,5,6,8,8a,9-octahydro-2H-phenanthren-1-yl]methoxy]-3-acetyloxy-4-hydroxyoxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 11497064 |
| Molecular Formula | C29H44O7 |
| Molecular Weight | 504.66 g/mol |
| Exact Mass | 504.31 |
| IUPAC Name | [(2S,3R,4R,5R)-5-[[(1S,4aR,4bS,7S,8aS)-7-ethenyl-1,4b,7-trimethyl-3,4,4a,5,6,8,8a,9-octahydro-2H-phenanthren-1-yl]methoxy]-3-acetyloxy-4-hydroxyoxolan-2-yl]methyl acetate |
| SMILES | C=C[C@@]1(C)CC[C@@]2(C)[C@@H](CC=C3[C@@H]2CCC[C@]3(C)CO[C@@H]2O[C@@H](COC(C)=O)[C@H](OC(C)=O)[C@H]2O)C1 |
| InChI | InChI=1S/C29H44O7/c1-7-27(4)13-14-29(6)20(15-27)10-11-21-22(29)9-8-12-28(21,5)17-34-26-24(32)25(35-19(3)31)23(36-26)16-33-18(2)30/h7,11,20,22-26,32H,1,8-10,12-17H2,2-6H3/t20-,22-,23-,24+,25-,26+,27-,28+,29-/m0/s1 |
| InChIKey | FSWRRPDHNDWYDW-VIABFYSESA-N |
| XLogP | 4.72 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.66 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|