C15H19FO — CID 114970764
(1-ethylcyclopentyl)-(4-fluoro-2-methylphenyl)methanone (PubChem CID 114970764) has the molecular formula C15H19FO and a molecular weight of 234.31 g/mol. Its IUPAC name is (1-ethylcyclopentyl)-(4-fluoro-2-methylphenyl)methanone.
| Compound Name | (1-ethylcyclopentyl)-(4-fluoro-2-methylphenyl)methanone |
|---|---|
| PubChem CID | 114970764 |
| Molecular Formula | C15H19FO |
| Molecular Weight | 234.31 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | (1-ethylcyclopentyl)-(4-fluoro-2-methylphenyl)methanone |
| SMILES | CCC1(C(=O)c2ccc(F)cc2C)CCCC1 |
| InChI | InChI=1S/C15H19FO/c1-3-15(8-4-5-9-15)14(17)13-7-6-12(16)10-11(13)2/h6-7,10H,3-5,8-9H2,1-2H3 |
| InChIKey | HVOCCVMAEGIXBB-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.31 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |