C15H20O4S — CID 114971121
(1,1-dioxothian-2-yl)-(4-propoxyphenyl)methanone (PubChem CID 114971121) has the molecular formula C15H20O4S and a molecular weight of 296.39 g/mol. Its IUPAC name is (1,1-dioxothian-2-yl)-(4-propoxyphenyl)methanone.
| Compound Name | (1,1-dioxothian-2-yl)-(4-propoxyphenyl)methanone |
|---|---|
| PubChem CID | 114971121 |
| Molecular Formula | C15H20O4S |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | (1,1-dioxothian-2-yl)-(4-propoxyphenyl)methanone |
| SMILES | CCCOc1ccc(C(=O)C2CCCCS2(=O)=O)cc1 |
| InChI | InChI=1S/C15H20O4S/c1-2-10-19-13-8-6-12(7-9-13)15(16)14-5-3-4-11-20(14,17)18/h6-9,14H,2-5,10-11H2,1H3 |
| InChIKey | VNSXBUXHUAIDQA-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |