About oxan-4-yl(thieno[3,2-b]thiophen-5-yl)methanone
oxan-4-yl(thieno[3,2-b]thiophen-5-yl)methanone (PubChem CID 114971804) has the molecular formula C12H12O2S2
and a molecular weight of 252.36 g/mol. Its IUPAC name is oxan-4-yl(thieno[3,2-b]thiophen-5-yl)methanone.
Molecular Properties
| Compound Name | oxan-4-yl(thieno[3,2-b]thiophen-5-yl)methanone |
| PubChem CID | 114971804 |
| Molecular Formula | C12H12O2S2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.03 |
| IUPAC Name | oxan-4-yl(thieno[3,2-b]thiophen-5-yl)methanone |
| SMILES | O=C(c1cc2sccc2s1)C1CCOCC1 |
| InChI | InChI=1S/C12H12O2S2/c13-12(8-1-4-14-5-2-8)11-7-10-9(16-11)3-6-15-10/h3,6-8H,1-2,4-5H2 |
| InChIKey | RJWYVSVRDULPSG-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze oxan-4-yl(thieno[3,2-b]thiophen-5-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxan-4-yl(thieno[3,2-b]thiophen-5-yl)methanone?
The IUPAC name of oxan-4-yl(thieno[3,2-b]thiophen-5-yl)methanone (CID 114971804) is oxan-4-yl(thieno[3,2-b]thiophen-5-yl)methanone.
What is the SMILES notation for oxan-4-yl(thieno[3,2-b]thiophen-5-yl)methanone?
The canonical SMILES for oxan-4-yl(thieno[3,2-b]thiophen-5-yl)methanone is O=C(c1cc2sccc2s1)C1CCOCC1.
What is the InChIKey of oxan-4-yl(thieno[3,2-b]thiophen-5-yl)methanone?
The InChIKey is RJWYVSVRDULPSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12O2S2/c13-12(8-1-4-14-5-2-8)11-7-10-9(16-11)3-6-15-10/h3,6-8H,1-2,4-5H2.
What are the key properties of oxan-4-yl(thieno[3,2-b]thiophen-5-yl)methanone?
oxan-4-yl(thieno[3,2-b]thiophen-5-yl)methanone has a molecular weight of 252.36 g/mol, XLogP of 3.57, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for oxan-4-yl(thieno[3,2-b]thiophen-5-yl)methanone is sourced from PubChem (CID 114971804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).