C12H10N2OS2 — CID 114972399
(2-ethylpyrazol-3-yl)-thieno[3,2-b]thiophen-5-ylmethanone (PubChem CID 114972399) has the molecular formula C12H10N2OS2 and a molecular weight of 262.36 g/mol. Its IUPAC name is (2-ethylpyrazol-3-yl)-thieno[3,2-b]thiophen-5-ylmethanone.
| Compound Name | (2-ethylpyrazol-3-yl)-thieno[3,2-b]thiophen-5-ylmethanone |
|---|---|
| PubChem CID | 114972399 |
| Molecular Formula | C12H10N2OS2 |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.02 |
| IUPAC Name | (2-ethylpyrazol-3-yl)-thieno[3,2-b]thiophen-5-ylmethanone |
| SMILES | CCn1nccc1C(=O)c1cc2sccc2s1 |
| InChI | InChI=1S/C12H10N2OS2/c1-2-14-8(3-5-13-14)12(15)11-7-10-9(17-11)4-6-16-10/h3-7H,2H2,1H3 |
| InChIKey | ZCFJYNUZTCCPFH-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |