C12H20N2O — CID 114972598
3,4,4-trimethyl-1-(2-methylpyrazol-3-yl)pentan-1-one (PubChem CID 114972598) has the molecular formula C12H20N2O and a molecular weight of 208.30 g/mol. Its IUPAC name is 3,4,4-trimethyl-1-(2-methylpyrazol-3-yl)pentan-1-one.
| Compound Name | 3,4,4-trimethyl-1-(2-methylpyrazol-3-yl)pentan-1-one |
|---|---|
| PubChem CID | 114972598 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | 3,4,4-trimethyl-1-(2-methylpyrazol-3-yl)pentan-1-one |
| SMILES | CC(CC(=O)c1ccnn1C)C(C)(C)C |
| InChI | InChI=1S/C12H20N2O/c1-9(12(2,3)4)8-11(15)10-6-7-13-14(10)5/h6-7,9H,8H2,1-5H3 |
| InChIKey | BDMDIWVMERFTON-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |