C12H18N2O2 — CID 114972690
(3-methyloxolan-2-yl)-(1-propylimidazol-2-yl)methanone (PubChem CID 114972690) has the molecular formula C12H18N2O2 and a molecular weight of 222.29 g/mol. Its IUPAC name is (3-methyloxolan-2-yl)-(1-propylimidazol-2-yl)methanone.
| Compound Name | (3-methyloxolan-2-yl)-(1-propylimidazol-2-yl)methanone |
|---|---|
| PubChem CID | 114972690 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | (3-methyloxolan-2-yl)-(1-propylimidazol-2-yl)methanone |
| SMILES | CCCn1ccnc1C(=O)C1OCCC1C |
| InChI | InChI=1S/C12H18N2O2/c1-3-6-14-7-5-13-12(14)10(15)11-9(2)4-8-16-11/h5,7,9,11H,3-4,6,8H2,1-2H3 |
| InChIKey | HLIGXLGDUZKVSK-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |