C29H40F3NO2Si — CID 11497279
[(1S)-1-[(2S,4aS,7R,8aR)-3-benzyl-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazin-2-yl]-2,2,2-trifluoro-1-phenylethoxy]-trimethylsilane (PubChem CID 11497279) has the molecular formula C29H40F3NO2Si and a molecular weight of 519.72 g/mol. Its IUPAC name is [(1S)-1-[(2S,4aS,7R,8aR)-3-benzyl-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazin-2-yl]-2,2,2-trifluoro-1-phenylethoxy]-trimethylsilane.
| Compound Name | [(1S)-1-[(2S,4aS,7R,8aR)-3-benzyl-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazin-2-yl]-2,2,2-trifluoro-1-phenylethoxy]-trimethylsilane |
|---|---|
| PubChem CID | 11497279 |
| Molecular Formula | C29H40F3NO2Si |
| Molecular Weight | 519.72 g/mol |
| Exact Mass | 519.28 |
| IUPAC Name | [(1S)-1-[(2S,4aS,7R,8aR)-3-benzyl-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazin-2-yl]-2,2,2-trifluoro-1-phenylethoxy]-trimethylsilane |
| SMILES | C[C@@H]1CC[C@@H]2[C@@H](C1)O[C@@H]([C@@](O[Si](C)(C)C)(c1ccccc1)C(F)(F)F)N(Cc1ccccc1)C2(C)C |
| InChI | InChI=1S/C29H40F3NO2Si/c1-21-17-18-24-25(19-21)34-26(33(27(24,2)3)20-22-13-9-7-10-14-22)28(29(30,31)32,35-36(4,5)6)23-15-11-8-12-16-23/h7-16,21,24-26H,17-20H2,1-6H3/t21-,24-,25-,26+,28+/m1/s1 |
| InChIKey | JFHINHIKQZKCPQ-ZORXRRSQSA-N |
| XLogP | 7.74 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.72 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|