C14H8F4O2 — CID 114972892
[4-(difluoromethoxy)phenyl]-(2,6-difluorophenyl)methanone (PubChem CID 114972892) has the molecular formula C14H8F4O2 and a molecular weight of 284.21 g/mol. Its IUPAC name is [4-(difluoromethoxy)phenyl]-(2,6-difluorophenyl)methanone.
| Compound Name | [4-(difluoromethoxy)phenyl]-(2,6-difluorophenyl)methanone |
|---|---|
| PubChem CID | 114972892 |
| Molecular Formula | C14H8F4O2 |
| Molecular Weight | 284.21 g/mol |
| Exact Mass | 284.05 |
| IUPAC Name | [4-(difluoromethoxy)phenyl]-(2,6-difluorophenyl)methanone |
| SMILES | O=C(c1ccc(OC(F)F)cc1)c1c(F)cccc1F |
| InChI | InChI=1S/C14H8F4O2/c15-10-2-1-3-11(16)12(10)13(19)8-4-6-9(7-5-8)20-14(17)18/h1-7,14H |
| InChIKey | GHERGSCRDUSUBG-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.21 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |