C14H24N2O — CID 114973012
1-(1-ethylimidazol-2-yl)-3,5,5-trimethylhexan-1-one (PubChem CID 114973012) has the molecular formula C14H24N2O and a molecular weight of 236.36 g/mol. Its IUPAC name is 1-(1-ethylimidazol-2-yl)-3,5,5-trimethylhexan-1-one.
| Compound Name | 1-(1-ethylimidazol-2-yl)-3,5,5-trimethylhexan-1-one |
|---|---|
| PubChem CID | 114973012 |
| Molecular Formula | C14H24N2O |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.19 |
| IUPAC Name | 1-(1-ethylimidazol-2-yl)-3,5,5-trimethylhexan-1-one |
| SMILES | CCn1ccnc1C(=O)CC(C)CC(C)(C)C |
| InChI | InChI=1S/C14H24N2O/c1-6-16-8-7-15-13(16)12(17)9-11(2)10-14(3,4)5/h7-8,11H,6,9-10H2,1-5H3 |
| InChIKey | CFRIQYAZAJUNEF-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |