C13H10N2O2 — CID 114973067
1,3-dihydro-2-benzofuran-5-yl(pyrazin-2-yl)methanone (PubChem CID 114973067) has the molecular formula C13H10N2O2 and a molecular weight of 226.24 g/mol. Its IUPAC name is 1,3-dihydro-2-benzofuran-5-yl(pyrazin-2-yl)methanone.
| Compound Name | 1,3-dihydro-2-benzofuran-5-yl(pyrazin-2-yl)methanone |
|---|---|
| PubChem CID | 114973067 |
| Molecular Formula | C13H10N2O2 |
| Molecular Weight | 226.24 g/mol |
| Exact Mass | 226.07 |
| IUPAC Name | 1,3-dihydro-2-benzofuran-5-yl(pyrazin-2-yl)methanone |
| SMILES | O=C(c1ccc2c(c1)COC2)c1cnccn1 |
| InChI | InChI=1S/C13H10N2O2/c16-13(12-6-14-3-4-15-12)9-1-2-10-7-17-8-11(10)5-9/h1-6H,7-8H2 |
| InChIKey | ULISJGSJYUOCLK-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.24 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |