C15H11Br3O2 — CID 114973645
2-(2-bromo-5-methoxyphenyl)-1-(2,5-dibromophenyl)ethanone (PubChem CID 114973645) has the molecular formula C15H11Br3O2 and a molecular weight of 462.96 g/mol. Its IUPAC name is 2-(2-bromo-5-methoxyphenyl)-1-(2,5-dibromophenyl)ethanone.
| Compound Name | 2-(2-bromo-5-methoxyphenyl)-1-(2,5-dibromophenyl)ethanone |
|---|---|
| PubChem CID | 114973645 |
| Molecular Formula | C15H11Br3O2 |
| Molecular Weight | 462.96 g/mol |
| Exact Mass | 459.83 |
| IUPAC Name | 2-(2-bromo-5-methoxyphenyl)-1-(2,5-dibromophenyl)ethanone |
| SMILES | COc1ccc(Br)c(CC(=O)c2cc(Br)ccc2Br)c1 |
| InChI | InChI=1S/C15H11Br3O2/c1-20-11-3-5-13(17)9(6-11)7-15(19)12-8-10(16)2-4-14(12)18/h2-6,8H,7H2,1H3 |
| InChIKey | NBLOEKYBSXUIAW-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.96 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |