C15H20Cl2O — CID 114973862
1-(2,5-dichlorophenyl)-4,5,5-trimethylhexan-2-one (PubChem CID 114973862) has the molecular formula C15H20Cl2O and a molecular weight of 287.23 g/mol. Its IUPAC name is 1-(2,5-dichlorophenyl)-4,5,5-trimethylhexan-2-one.
| Compound Name | 1-(2,5-dichlorophenyl)-4,5,5-trimethylhexan-2-one |
|---|---|
| PubChem CID | 114973862 |
| Molecular Formula | C15H20Cl2O |
| Molecular Weight | 287.23 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | 1-(2,5-dichlorophenyl)-4,5,5-trimethylhexan-2-one |
| SMILES | CC(CC(=O)Cc1cc(Cl)ccc1Cl)C(C)(C)C |
| InChI | InChI=1S/C15H20Cl2O/c1-10(15(2,3)4)7-13(18)9-11-8-12(16)5-6-14(11)17/h5-6,8,10H,7,9H2,1-4H3 |
| InChIKey | NNGXYVWGBYYVCC-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.23 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |