C16H13IO2 — CID 114974112
1-(1,3-dihydro-2-benzofuran-5-yl)-2-(4-iodophenyl)ethanone (PubChem CID 114974112) has the molecular formula C16H13IO2 and a molecular weight of 364.18 g/mol. Its IUPAC name is 1-(1,3-dihydro-2-benzofuran-5-yl)-2-(4-iodophenyl)ethanone.
| Compound Name | 1-(1,3-dihydro-2-benzofuran-5-yl)-2-(4-iodophenyl)ethanone |
|---|---|
| PubChem CID | 114974112 |
| Molecular Formula | C16H13IO2 |
| Molecular Weight | 364.18 g/mol |
| Exact Mass | 364.00 |
| IUPAC Name | 1-(1,3-dihydro-2-benzofuran-5-yl)-2-(4-iodophenyl)ethanone |
| SMILES | O=C(Cc1ccc(I)cc1)c1ccc2c(c1)COC2 |
| InChI | InChI=1S/C16H13IO2/c17-15-5-1-11(2-6-15)7-16(18)12-3-4-13-9-19-10-14(13)8-12/h1-6,8H,7,9-10H2 |
| InChIKey | HVVAICADWIBNNM-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.18 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|