C15H22O2 — CID 114974365
1-(4-methoxyphenyl)-4,4-dimethylhexan-3-one (PubChem CID 114974365) has the molecular formula C15H22O2 and a molecular weight of 234.34 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-4,4-dimethylhexan-3-one.
| Compound Name | 1-(4-methoxyphenyl)-4,4-dimethylhexan-3-one |
|---|---|
| PubChem CID | 114974365 |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | 1-(4-methoxyphenyl)-4,4-dimethylhexan-3-one |
| SMILES | CCC(C)(C)C(=O)CCc1ccc(OC)cc1 |
| InChI | InChI=1S/C15H22O2/c1-5-15(2,3)14(16)11-8-12-6-9-13(17-4)10-7-12/h6-7,9-10H,5,8,11H2,1-4H3 |
| InChIKey | AWNRATSMTBBAOL-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |