C26H26F7NO3 — CID 11497451
(3S,5S)-5-[(1R,2R,3S)-3-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2-(4-fluorophenyl)cyclopentyl]-3-hydroxy-5-methylpyrrolidin-2-one (PubChem CID 11497451) has the molecular formula C26H26F7NO3 and a molecular weight of 533.48 g/mol. Its IUPAC name is (3S,5S)-5-[(1R,2R,3S)-3-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2-(4-fluorophenyl)cyclopentyl]-3-hydroxy-5-methylpyrrolidin-2-one.
| Compound Name | (3S,5S)-5-[(1R,2R,3S)-3-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2-(4-fluorophenyl)cyclopentyl]-3-hydroxy-5-methylpyrrolidin-2-one |
|---|---|
| PubChem CID | 11497451 |
| Molecular Formula | C26H26F7NO3 |
| Molecular Weight | 533.48 g/mol |
| Exact Mass | 533.18 |
| IUPAC Name | (3S,5S)-5-[(1R,2R,3S)-3-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2-(4-fluorophenyl)cyclopentyl]-3-hydroxy-5-methylpyrrolidin-2-one |
| SMILES | C[C@@H](O[C@H]1CC[C@@H]([C@]2(C)C[C@H](O)C(=O)N2)[C@@H]1c1ccc(F)cc1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C26H26F7NO3/c1-13(15-9-16(25(28,29)30)11-17(10-15)26(31,32)33)37-21-8-7-19(24(2)12-20(35)23(36)34-24)22(21)14-3-5-18(27)6-4-14/h3-6,9-11,13,19-22,35H,7-8,12H2,1-2H3,(H,34,36)/t13-,19-,20+,21+,22+,24+/m1/s1 |
| InChIKey | RVNGXNHKLACPNN-WIYHBKLWSA-N |
| XLogP | 6.14 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.48 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |