C33H33NO6 — CID 11497534
ditert-butyl 5'-(2,6-dimethylphenyl)imino-2-oxospiro[acenaphthylene-1,2'-furan]-3',4'-dicarboxylate (PubChem CID 11497534) has the molecular formula C33H33NO6 and a molecular weight of 539.63 g/mol. Its IUPAC name is ditert-butyl 5'-(2,6-dimethylphenyl)imino-2-oxospiro[acenaphthylene-1,2'-furan]-3',4'-dicarboxylate.
| Compound Name | ditert-butyl 5'-(2,6-dimethylphenyl)imino-2-oxospiro[acenaphthylene-1,2'-furan]-3',4'-dicarboxylate |
|---|---|
| PubChem CID | 11497534 |
| Molecular Formula | C33H33NO6 |
| Molecular Weight | 539.63 g/mol |
| Exact Mass | 539.23 |
| IUPAC Name | ditert-butyl 5'-(2,6-dimethylphenyl)imino-2-oxospiro[acenaphthylene-1,2'-furan]-3',4'-dicarboxylate |
| SMILES | Cc1cccc(C)c1/N=C1\OC2(C(=O)c3cccc4cccc2c34)C(C(=O)OC(C)(C)C)=C1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C33H33NO6/c1-18-12-9-13-19(2)26(18)34-28-24(29(36)39-31(3,4)5)25(30(37)40-32(6,7)8)33(38-28)22-17-11-15-20-14-10-16-21(23(20)22)27(33)35/h9-17H,1-8H3/b34-28- |
| InChIKey | FOPRUXGVMDXARJ-BFYITVNDSA-N |
| XLogP | 6.59 |
| TPSA | 91.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.63 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|