C13H20N2O2 — CID 114975728
1-(2-methyloxolan-3-yl)-2-(1-propan-2-ylpyrazol-3-yl)ethanone (PubChem CID 114975728) has the molecular formula C13H20N2O2 and a molecular weight of 236.31 g/mol. Its IUPAC name is 1-(2-methyloxolan-3-yl)-2-(1-propan-2-ylpyrazol-3-yl)ethanone.
| Compound Name | 1-(2-methyloxolan-3-yl)-2-(1-propan-2-ylpyrazol-3-yl)ethanone |
|---|---|
| PubChem CID | 114975728 |
| Molecular Formula | C13H20N2O2 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | 1-(2-methyloxolan-3-yl)-2-(1-propan-2-ylpyrazol-3-yl)ethanone |
| SMILES | CC1OCCC1C(=O)Cc1ccn(C(C)C)n1 |
| InChI | InChI=1S/C13H20N2O2/c1-9(2)15-6-4-11(14-15)8-13(16)12-5-7-17-10(12)3/h4,6,9-10,12H,5,7-8H2,1-3H3 |
| InChIKey | XYPVVFVCNNJFFG-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |