C26H19Cl3N2O5 — CID 11497604
2-[3-chloro-4-[4-[2-(2,4-dichlorophenoxy)ethylcarbamoyl]-5-phenyl-1,2-oxazol-3-yl]phenyl]acetic acid (PubChem CID 11497604) has the molecular formula C26H19Cl3N2O5 and a molecular weight of 545.81 g/mol. Its IUPAC name is 2-[3-chloro-4-[4-[2-(2,4-dichlorophenoxy)ethylcarbamoyl]-5-phenyl-1,2-oxazol-3-yl]phenyl]acetic acid.
| Compound Name | 2-[3-chloro-4-[4-[2-(2,4-dichlorophenoxy)ethylcarbamoyl]-5-phenyl-1,2-oxazol-3-yl]phenyl]acetic acid |
|---|---|
| PubChem CID | 11497604 |
| Molecular Formula | C26H19Cl3N2O5 |
| Molecular Weight | 545.81 g/mol |
| Exact Mass | 544.04 |
| IUPAC Name | 2-[3-chloro-4-[4-[2-(2,4-dichlorophenoxy)ethylcarbamoyl]-5-phenyl-1,2-oxazol-3-yl]phenyl]acetic acid |
| SMILES | O=C(O)Cc1ccc(-c2noc(-c3ccccc3)c2C(=O)NCCOc2ccc(Cl)cc2Cl)c(Cl)c1 |
| InChI | InChI=1S/C26H19Cl3N2O5/c27-17-7-9-21(20(29)14-17)35-11-10-30-26(34)23-24(31-36-25(23)16-4-2-1-3-5-16)18-8-6-15(12-19(18)28)13-22(32)33/h1-9,12,14H,10-11,13H2,(H,30,34)(H,32,33) |
| InChIKey | SUEZNXXKBMUSQM-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 101.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.81 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|