C17H25F3O — CID 114976593
1-(3,5-dimethyl-1-adamantyl)-5,5,5-trifluoropentan-2-one (PubChem CID 114976593) has the molecular formula C17H25F3O and a molecular weight of 302.38 g/mol. Its IUPAC name is 1-(3,5-dimethyl-1-adamantyl)-5,5,5-trifluoropentan-2-one.
| Compound Name | 1-(3,5-dimethyl-1-adamantyl)-5,5,5-trifluoropentan-2-one |
|---|---|
| PubChem CID | 114976593 |
| Molecular Formula | C17H25F3O |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | 1-(3,5-dimethyl-1-adamantyl)-5,5,5-trifluoropentan-2-one |
| SMILES | CC12CC3CC(C)(C1)CC(CC(=O)CCC(F)(F)F)(C3)C2 |
| InChI | InChI=1S/C17H25F3O/c1-14-5-12-6-15(2,9-14)11-16(7-12,10-14)8-13(21)3-4-17(18,19)20/h12H,3-11H2,1-2H3 |
| InChIKey | UYKZDLMLBXZUKZ-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |