C18H22N2O — CID 114977377
2-(1-cyclopentylpyrazol-3-yl)-1-(2,3-dimethylphenyl)ethanone (PubChem CID 114977377) has the molecular formula C18H22N2O and a molecular weight of 282.39 g/mol. Its IUPAC name is 2-(1-cyclopentylpyrazol-3-yl)-1-(2,3-dimethylphenyl)ethanone.
| Compound Name | 2-(1-cyclopentylpyrazol-3-yl)-1-(2,3-dimethylphenyl)ethanone |
|---|---|
| PubChem CID | 114977377 |
| Molecular Formula | C18H22N2O |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | 2-(1-cyclopentylpyrazol-3-yl)-1-(2,3-dimethylphenyl)ethanone |
| SMILES | Cc1cccc(C(=O)Cc2ccn(C3CCCC3)n2)c1C |
| InChI | InChI=1S/C18H22N2O/c1-13-6-5-9-17(14(13)2)18(21)12-15-10-11-20(19-15)16-7-3-4-8-16/h5-6,9-11,16H,3-4,7-8,12H2,1-2H3 |
| InChIKey | AXZZFNSSVFQAPK-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |