C14H19N — CID 114977590
1-(2,5-dimethylphenyl)-N-methylpent-4-yn-2-amine (PubChem CID 114977590) has the molecular formula C14H19N and a molecular weight of 201.31 g/mol. Its IUPAC name is 1-(2,5-dimethylphenyl)-N-methylpent-4-yn-2-amine.
| Compound Name | 1-(2,5-dimethylphenyl)-N-methylpent-4-yn-2-amine |
|---|---|
| PubChem CID | 114977590 |
| Molecular Formula | C14H19N |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | 1-(2,5-dimethylphenyl)-N-methylpent-4-yn-2-amine |
| SMILES | C#CCC(Cc1cc(C)ccc1C)NC |
| InChI | InChI=1S/C14H19N/c1-5-6-14(15-4)10-13-9-11(2)7-8-12(13)3/h1,7-9,14-15H,6,10H2,2-4H3 |
| InChIKey | WPFKHUXKCGMTRI-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|