C13H16ClN — CID 114977880
1-(5-chloro-2-methylphenyl)-N-ethylbut-3-yn-1-amine (PubChem CID 114977880) has the molecular formula C13H16ClN and a molecular weight of 221.73 g/mol. Its IUPAC name is 1-(5-chloro-2-methylphenyl)-N-ethylbut-3-yn-1-amine.
| Compound Name | 1-(5-chloro-2-methylphenyl)-N-ethylbut-3-yn-1-amine |
|---|---|
| PubChem CID | 114977880 |
| Molecular Formula | C13H16ClN |
| Molecular Weight | 221.73 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | 1-(5-chloro-2-methylphenyl)-N-ethylbut-3-yn-1-amine |
| SMILES | C#CCC(NCC)c1cc(Cl)ccc1C |
| InChI | InChI=1S/C13H16ClN/c1-4-6-13(15-5-2)12-9-11(14)8-7-10(12)3/h1,7-9,13,15H,5-6H2,2-3H3 |
| InChIKey | CZLNGIDJKXZRKN-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.73 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|