C18H10Br2ClO3PS2 — CID 11497801
3,7-dibromo-11-(4-chlorophenoxy)-11-sulfanylidenebenzo[d][1,3,6,2]benzodioxathiaphosphocine (PubChem CID 11497801) has the molecular formula C18H10Br2ClO3PS2 and a molecular weight of 564.64 g/mol. Its IUPAC name is 3,7-dibromo-11-(4-chlorophenoxy)-11-sulfanylidenebenzo[d][1,3,6,2]benzodioxathiaphosphocine.
| Compound Name | 3,7-dibromo-11-(4-chlorophenoxy)-11-sulfanylidenebenzo[d][1,3,6,2]benzodioxathiaphosphocine |
|---|---|
| PubChem CID | 11497801 |
| Molecular Formula | C18H10Br2ClO3PS2 |
| Molecular Weight | 564.64 g/mol |
| Exact Mass | 561.79 |
| IUPAC Name | 3,7-dibromo-11-(4-chlorophenoxy)-11-sulfanylidenebenzo[d][1,3,6,2]benzodioxathiaphosphocine |
| SMILES | S=P1(Oc2ccc(Cl)cc2)Oc2ccc(Br)cc2Sc2cc(Br)ccc2O1 |
| InChI | InChI=1S/C18H10Br2ClO3PS2/c19-11-1-7-15-17(9-11)27-18-10-12(20)2-8-16(18)24-25(26,23-15)22-14-5-3-13(21)4-6-14/h1-10H |
| InChIKey | JMLHJZHFPWHXCF-UHFFFAOYSA-N |
| XLogP | 8.09 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.64 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|