C22H42Cl3N9O2 — CID 11497853
3,5-diamino-6-chloro-N-[N'-[11-[3-(dimethylamino)propylamino]-11-oxoundecyl]carbamimidoyl]pyrazine-2-carboxamide;dihydrochloride (PubChem CID 11497853) has the molecular formula C22H42Cl3N9O2 and a molecular weight of 571.00 g/mol. Its IUPAC name is 3,5-diamino-6-chloro-N-[N'-[11-[3-(dimethylamino)propylamino]-11-oxoundecyl]carbamimidoyl]pyrazine-2-carboxamide;dihydrochloride.
| Compound Name | 3,5-diamino-6-chloro-N-[N'-[11-[3-(dimethylamino)propylamino]-11-oxoundecyl]carbamimidoyl]pyrazine-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 11497853 |
| Molecular Formula | C22H42Cl3N9O2 |
| Molecular Weight | 571.00 g/mol |
| Exact Mass | 569.25 |
| IUPAC Name | 3,5-diamino-6-chloro-N-[N'-[11-[3-(dimethylamino)propylamino]-11-oxoundecyl]carbamimidoyl]pyrazine-2-carboxamide;dihydrochloride |
| SMILES | CN(C)CCCNC(=O)CCCCCCCCCC/N=C(\N)NC(=O)c1nc(Cl)c(N)nc1N.Cl.Cl |
| InChI | InChI=1S/C22H40ClN9O2.2ClH/c1-32(2)15-11-14-27-16(33)12-9-7-5-3-4-6-8-10-13-28-22(26)31-21(34)17-19(24)30-20(25)18(23)29-17;;/h3-15H2,1-2H3,(H,27,33)(H4,24,25,30)(H3,26,28,31,34);2*1H |
| InChIKey | AZUFLKJIHBZVHL-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 177.64 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.00 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|