C22H40ClN9O2 — CID 11497854
3,5-diamino-6-chloro-N-[N'-[11-[3-(dimethylamino)propylamino]-11-oxoundecyl]carbamimidoyl]pyrazine-2-carboxamide (PubChem CID 11497854) has the molecular formula C22H40ClN9O2 and a molecular weight of 498.08 g/mol. Its IUPAC name is 3,5-diamino-6-chloro-N-[N'-[11-[3-(dimethylamino)propylamino]-11-oxoundecyl]carbamimidoyl]pyrazine-2-carboxamide.
| Compound Name | 3,5-diamino-6-chloro-N-[N'-[11-[3-(dimethylamino)propylamino]-11-oxoundecyl]carbamimidoyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 11497854 |
| Molecular Formula | C22H40ClN9O2 |
| Molecular Weight | 498.08 g/mol |
| Exact Mass | 497.30 |
| IUPAC Name | 3,5-diamino-6-chloro-N-[N'-[11-[3-(dimethylamino)propylamino]-11-oxoundecyl]carbamimidoyl]pyrazine-2-carboxamide |
| SMILES | CN(C)CCCNC(=O)CCCCCCCCCC/N=C(\N)NC(=O)c1nc(Cl)c(N)nc1N |
| InChI | InChI=1S/C22H40ClN9O2/c1-32(2)15-11-14-27-16(33)12-9-7-5-3-4-6-8-10-13-28-22(26)31-21(34)17-19(24)30-20(25)18(23)29-17/h3-15H2,1-2H3,(H,27,33)(H4,24,25,30)(H3,26,28,31,34) |
| InChIKey | LOUUDDNPRXYEGF-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 177.64 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.08 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|