C16H17ClO — CID 114979043
1-(3-chloro-4-methylphenyl)-3-phenylpropan-1-ol (PubChem CID 114979043) has the molecular formula C16H17ClO and a molecular weight of 260.76 g/mol. Its IUPAC name is 1-(3-chloro-4-methylphenyl)-3-phenylpropan-1-ol.
| Compound Name | 1-(3-chloro-4-methylphenyl)-3-phenylpropan-1-ol |
|---|---|
| PubChem CID | 114979043 |
| Molecular Formula | C16H17ClO |
| Molecular Weight | 260.76 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | 1-(3-chloro-4-methylphenyl)-3-phenylpropan-1-ol |
| SMILES | Cc1ccc(C(O)CCc2ccccc2)cc1Cl |
| InChI | InChI=1S/C16H17ClO/c1-12-7-9-14(11-15(12)17)16(18)10-8-13-5-3-2-4-6-13/h2-7,9,11,16,18H,8,10H2,1H3 |
| InChIKey | KSRMZMGZPRVGSX-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.76 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |