C12H19ClN2O — CID 114979229
1-(4-chloro-1,3-dimethylpyrazol-5-yl)heptan-2-one (PubChem CID 114979229) has the molecular formula C12H19ClN2O and a molecular weight of 242.75 g/mol. Its IUPAC name is 1-(4-chloro-1,3-dimethylpyrazol-5-yl)heptan-2-one.
| Compound Name | 1-(4-chloro-1,3-dimethylpyrazol-5-yl)heptan-2-one |
|---|---|
| PubChem CID | 114979229 |
| Molecular Formula | C12H19ClN2O |
| Molecular Weight | 242.75 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 1-(4-chloro-1,3-dimethylpyrazol-5-yl)heptan-2-one |
| SMILES | CCCCCC(=O)Cc1c(Cl)c(C)nn1C |
| InChI | InChI=1S/C12H19ClN2O/c1-4-5-6-7-10(16)8-11-12(13)9(2)14-15(11)3/h4-8H2,1-3H3 |
| InChIKey | NKBIOJLTDGWVGK-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.75 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|